Systematic / IUPAC Name: 2-({1,1,1,3,3,3-Hexafluoro-2-[(isopropoxycarbonyl)amino]-2-propanyl}amino)benzoic acid
ID: Reference3772
Other Names:
2-[(1,1,1,3,3,3-Hexafluoro-2-{[(propan-2-yloxy)carbonyl]amino}propan-2-yl)amino]benzoic acid;
Benzoic acid, 2-[(2,2,2-trifluoro-1-{[(1-methylethoxy)carbonyl]amino}-1-(trifluoromethyl)ethyl)amino]-
Formula: C14H14F6N2O4
2-{[2,2,2-Trifluoro-1-[(isopropoxycarbonyl)amino]-1-(trifluoromethyl)ethyl]amino}benzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/10/2016 7:31:05 AM |
| InChI | InChI=1S/C14H14F6N2O4/c1-7(2)26-11(25)22-12(13(15,16)17,14(18,19)20)21-9-6-4-3-5-8(9)10(23)24/h3-7,21H,1-2H3,(H,22,25)(H,23,24) |
| InChI Key | QTRWNZRHWSHUSX-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC(=O)NC(C(F)(F)F)(C(F)(F)F)NC1=CC=CC=C1C(=O)O |
| CAS | |
| Splash | |
| Other Names |
2-[(1,1,1,3,3,3-Hexafluoro-2-{[(propan-2-yloxy)carbonyl]amino}propan-2-yl)amino]benzoic acid; Benzoic acid, 2-[(2,2,2-trifluoro-1-{[(1-methylethoxy)carbonyl]amino}-1-(trifluoromethyl)ethyl)amino]- |
| ChEMBL | CHEMBL1706886 |
| ChemSpider | 1364677 |
| PubChem | 1717181 |