Systematic / IUPAC Name: 5-Methyl-N-(2H-tetrazol-5-yl)-2-pyrazinecarboxamide
ID: Reference3777
Other Names: 2-Pyrazinecarboxamide, 5-methyl-N-2H-tetrazol-5-yl-
Formula: C7H7N7O
5-Methyl-N-(1H-1,2,3,4-tetraazol-5-yl)-2-pyrazinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 69 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/10/2016 9:27:51 AM |
| InChI | InChI=1S/C7H7N7O/c1-4-2-9-5(3-8-4)6(15)10-7-11-13-14-12-7/h2-3H,1H3,(H2,10,11,12,13,14,15) |
| InChI Key | UFRVVLAWGLMXSD-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NC=C(N=C1)C(=O)NC2=NNN=N2 |
| CAS | |
| Splash | |
| Other Names | 2-Pyrazinecarboxamide, 5-methyl-N-2H-tetrazol-5-yl- |