Systematic / IUPAC Name: N-({5-[(2-Chlorophenyl)sulfamoyl]-2-thienyl}methyl)benzamide
ID: Reference3802
Other Names:
N-({5-[(2-Chlorophenyl)sulfamoyl]thiophen-2-yl}methyl)benzamide;
Benzamide, N-[(5-{[(2-chlorophenyl)amino]sulfonyl}-2-thienyl)methyl]-
Formula: C18H15ClN2O3S2
N-({5-[(2-Chloroanilino)sulfonyl]-2-thienyl}methyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/11/2016 12:10:33 PM |
| InChI | InChI=1S/C18H15ClN2O3S2/c19-15-8-4-5-9-16(15)21-26(23,24)17-11-10-14(25-17)12-20-18(22)13-6-2-1-3-7-13/h1-11,21H,12H2,(H,20,22) |
| InChI Key | FQZWTAHMMYYNCW-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)NCC2=CC=C(S2)S(=O)(=O)NC3=CC=CC=C3Cl |
| CAS | |
| Splash | |
| Other Names |
N-({5-[(2-Chlorophenyl)sulfamoyl]thiophen-2-yl}methyl)benzamide; Benzamide, N-[(5-{[(2-chlorophenyl)amino]sulfonyl}-2-thienyl)methyl]- |
| ChemSpider | 2101897 |
| ChEMBL | CHEMBL1725687 |
| PubChem | 2823685 |