Systematic / IUPAC Name: 4,6-Bis(2-furyl)-2-oxo-1,2-dihydro-3-pyridinecarbonitrile
ID: Reference3804
Other Names: 4,6-Bis(furan-2-yl)-2-oxo-1H-pyridine-3-carbonitrile
Formula: C14H8N2O3
4,6-Bis(2-furyl)-2-oxo-1,2-dihydro-3-pyridinecarbonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/11/2016 1:59:32 PM |
| InChI | InChI=1S/C14H8N2O3/c15-8-10-9(12-3-1-5-18-12)7-11(16-14(10)17)13-4-2-6-19-13/h1-7H,(H,16,17) |
| InChI Key | ARMMSYKNUYSKMA-UHFFFAOYSA-N |
| Canonical SMILES | C1=COC(=C1)C2=CC(=C(C(=O)N2)C#N)C3=CC=CO3 |
| CAS | |
| Splash | |
| Other Names | 4,6-Bis(furan-2-yl)-2-oxo-1H-pyridine-3-carbonitrile |