Systematic / IUPAC Name: N-(2-Chlorophenyl)-4-(methylsulfonyl)benzamide
ID: Reference3808
Other Names:
N-(2-Chlorophenyl)-4-methanesulfonylbenzamide;
Benzamide, N-(2-chlorophenyl)-4-(methylsulfonyl)-
Formula: C14H12ClNO3S
N-(2-Chlorophenyl)-4-(methylsulfonyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 242 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 7:16:38 AM |
| InChI | InChI=1S/C14H12ClNO3S/c1-20(18,19)11-8-6-10(7-9-11)14(17)16-13-5-3-2-4-12(13)15/h2-9H,1H3,(H,16,17) |
| InChI Key | IZWJJDAFDSBMNF-UHFFFAOYSA-N |
| Canonical SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2Cl |
| CAS | |
| Splash | |
| Other Names |
N-(2-Chlorophenyl)-4-methanesulfonylbenzamide; Benzamide, N-(2-chlorophenyl)-4-(methylsulfonyl)- |
| ChEMBL | CHEMBL1714091 |
| PubChem | 2747545 |
| ChemSpider | 2028993 |