Systematic / IUPAC Name: 5-Bromo-2-iodobenzenesulfonamide
ID: Reference3809
Other Names: Benzenesulfonamide, 5-bromo-2-iodo-
Formula: C6H5BrINO2S
5-Bromo-2-iodobenzene-1-sulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/11/2016 2:25:17 PM |
| InChI | InChI=1S/C6H5BrINO2S/c7-4-1-2-5(8)6(3-4)12(9,10)11/h1-3H,(H2,9,10,11) |
| InChI Key | VDMMQNKGIWVTGX-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1Br)S(=O)(=O)N)I |
| CAS | |
| Splash | |
| Other Names | Benzenesulfonamide, 5-bromo-2-iodo- |