Systematic / IUPAC Name: 2-{(E)-2-[4-(Diethylamino)phenyl]vinyl}-5-nitrobenzonitrile
ID: Reference3816
Other Names: Benzonitrile, 2-{(E)-2-[4-(diethylamino)phenyl]ethenyl}-5-nitro-
Formula: C19H19N3O2
2-[4-(Diethylamino)styryl]-5-nitrobenzonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 8:14:23 AM |
| InChI | InChI=1S/C19H19N3O2/c1-3-21(4-2)18-10-6-15(7-11-18)5-8-16-9-12-19(22(23)24)13-17(16)14-20/h5-13H,3-4H2,1-2H3/b8-5+ |
| InChI Key | IIVJPUYMNRMMPU-VMPITWQZSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Benzonitrile, 2-{(E)-2-[4-(diethylamino)phenyl]ethenyl}-5-nitro- |