Systematic / IUPAC Name: 1-(2-Fluorophenyl)-4-[(E)-(2-thienylmethylene)amino]-2,5-piperazinedione
ID: Reference3824
Other Names: 2,5-Piperazinedione, 1-(2-fluorophenyl)-4-{[(1E)-2-thienylmethylene]amino}-
Formula: C15H12FN3O2S
1-(2-Fluorophenyl)-4-[(2-thienylmethylene)amino]tetrahydro-2,5-pyrazinedione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 9:08:54 AM |
| InChI | InChI=1S/C15H12FN3O2S/c16-12-5-1-2-6-13(12)18-9-15(21)19(10-14(18)20)17-8-11-4-3-7-22-11/h1-8H,9-10H2/b17-8+ |
| InChI Key | KKDYBJBWTOAZGO-CAOOACKPSA-N |
| Canonical SMILES | C1C(=O)N(CC(=O)N1C2=CC=CC=C2F)N=CC3=CC=CS3 |
| CAS | |
| Splash | |
| Other Names | 2,5-Piperazinedione, 1-(2-fluorophenyl)-4-{[(1E)-2-thienylmethylene]amino}- |