Systematic / IUPAC Name: 1,4-Bis(3-methyl-2-phenyl-4-morpholinyl)-1,4-butanedione
ID: Reference3828
Other Names: 1,4-Butanedione, 1,4-bis(3-methyl-2-phenyl-4-morpholinyl)-
Formula: C26H32N2O4
1,4-Bis(3-methyl-2-phenylmorpholino)butane-1,4-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 9:17:42 AM |
| InChI | InChI=1S/C26H32N2O4/c1-19-25(21-9-5-3-6-10-21)31-17-15-27(19)23(29)13-14-24(30)28-16-18-32-26(20(28)2)22-11-7-4-8-12-22/h3-12,19-20,25-26H,13-18H2,1-2H3 |
| InChI Key | TVNQPXYDUXKBNI-UHFFFAOYSA-N |
| Canonical SMILES | CC1C(OCCN1C(=O)CCC(=O)N2CCOC(C2C)C3=CC=CC=C3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | 1,4-Butanedione, 1,4-bis(3-methyl-2-phenyl-4-morpholinyl)- |