Systematic / IUPAC Name: 3-(4-Hydroxyphenyl)-N'-[(E)-(4-oxo-4H-chromen-3-yl)methylene]propanehydrazide
ID: Reference3834
            Other Names: 
                    N'1-[(4-Oxo-4H-chromen-3-yl)methylidene]-3-(4-hydroxyphenyl)propanohydrazide ; 
                    Benzenepropanoic acid, 4-hydroxy, 2-[(1E)-(4-oxo-4H-1-benzopyran-3-yl)methylene]hydrazide
        
Formula: C19H16N2O4
N'1-[(4-Oxo-4H-chromen-3-yl)methylidene]-3-(4-hydroxyphenyl)propanohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap | 
| No. of Spectral Trees | 2 | 
| No. of Spectra | 238 | 
| Tandem Spectra | MS1, MS2 | 
| Ionization Methods | ESI | 
| Analyzers | FT | 
| Last Modification | 2/15/2016 9:46:10 AM | 
| InChI | InChI=1S/C19H16N2O4/c22-15-8-5-13(6-9-15)7-10-18(23)21-20-11-14-12-25-17-4-2-1-3-16(17)19(14)24/h1-6,8-9,11-12,22H,7,10H2,(H,21,23)/b20-11+ | 
| InChI Key | TTYAJTCHBAXHGP-RGVLZGJSSA-N | 
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)C(=CO2)C=NNC(=O)CCC3=CC=C(C=C3)O | 
| CAS | |
| Splash | |
| Other Names | 
                        N'1-[(4-Oxo-4H-chromen-3-yl)methylidene]-3-(4-hydroxyphenyl)propanohydrazide ;  Benzenepropanoic acid, 4-hydroxy, 2-[(1E)-(4-oxo-4H-1-benzopyran-3-yl)methylene]hydrazide  | 
                    
| ChemSpider | 7840894 | 
| PubChem | 9566176 | 
| ChEMBL | CHEMBL3199030 |