Systematic / IUPAC Name: N'-{[(5-Methyl-3-phenyl-1,2-oxazol-4-yl)carbonyl]oxy}-5-nitro-2-furancarboximidamide
ID: Reference3836
Other Names: 5-Methyl-3-phenyl-isoxazole-4-carboxylic acid {[amino-(5-nitro-2-furyl)methylene]amino} ester
Formula: C16H12N4O6
O2-[(5-Methyl-3-phenylisoxazol-4-yl)carbonyl]-5-nitrofuran-2-carbohydroximamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 236 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 10:02:22 AM |
| InChI | InChI=1S/C16H12N4O6/c1-9-13(14(18-25-9)10-5-3-2-4-6-10)16(21)26-19-15(17)11-7-8-12(24-11)20(22)23/h2-8H,1H3,(H2,17,19) |
| InChI Key | OQKXCADKZOYPNT-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 5-Methyl-3-phenyl-isoxazole-4-carboxylic acid {[amino-(5-nitro-2-furyl)methylene]amino} ester |
| ChEMBL | CHEMBL1461482 |
| PubChem | 2726624; 6364730; 5844273 |
| ChemSpider | 2008685 |