Systematic / IUPAC Name: 2-(2,6-Dichlorobenzyl)-N-(2-thienylmethyl)-1,3-thiazole-4-carboxamide
ID: Reference3837
Other Names: 4-Thiazolecarboxamide, 2-[(2,6-dichlorophenyl)methyl]-N-(2-thienylmethyl)-
Formula: C16H12Cl2N2OS2
N4-(2-Thienylmethyl)-2-(2,6-dichlorobenzyl)-1,3-thiazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 10:08:06 AM |
| InChI | InChI=1S/C16H12Cl2N2OS2/c17-12-4-1-5-13(18)11(12)7-15-20-14(9-23-15)16(21)19-8-10-3-2-6-22-10/h1-6,9H,7-8H2,(H,19,21) |
| InChI Key | NFQBECYKFWDRLL-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)CC2=NC(=CS2)C(=O)NCC3=CC=CS3)Cl |
| CAS | |
| Splash | |
| Other Names | 4-Thiazolecarboxamide, 2-[(2,6-dichlorophenyl)methyl]-N-(2-thienylmethyl)- |