Systematic / IUPAC Name: [4-(3,4-Dichlorophenyl)-1,3-thiazol-2-yl]acetonitrile
ID: Reference3840
Other Names: 2-Thiazoleacetonitrile, 4-(3,4-dichlorophenyl)-
Formula: C11H6Cl2N2S
2-[4-(3,4-Dichlorophenyl)-1,3-thiazol-2-yl]acetonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 10:24:54 AM |
| InChI | InChI=1S/C11H6Cl2N2S/c12-8-2-1-7(5-9(8)13)10-6-16-11(15-10)3-4-14/h1-2,5-6H,3H2 |
| InChI Key | QUKXPETXDIENML-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1C2=CSC(=N2)CC#N)Cl)Cl |
| CAS | 637015806 |
| Splash | |
| Other Names | 2-Thiazoleacetonitrile, 4-(3,4-dichlorophenyl)- |