Systematic / IUPAC Name: 2-{[2-(2,2,2-Trifluoroethoxy)-5-(trifluoromethyl)phenyl]hydrazono}-1,3-cyclohexanedione
ID: Reference3851
Other Names: 1,2,3-Cyclohexanetrione, 2-{2-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)phenyl]hydrazone}
Formula: C15H12F6N2O3
2-{2-[2-(2,2,2-Trifluoroethoxy)-5-(trifluoromethyl)phenyl]hydrazono}cyclohexane-1,3-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 1:58:36 PM |
| InChI | InChI=1S/C15H12F6N2O3/c16-14(17,18)7-26-12-5-4-8(15(19,20)21)6-9(12)22-23-13-10(24)2-1-3-11(13)25/h4-6,22H,1-3,7H2 |
| InChI Key | DBMINRRWZGUOKN-UHFFFAOYSA-N |
| Canonical SMILES | C1CC(=O)C(=NNC2=C(C=CC(=C2)C(F)(F)F)OCC(F)(F)F)C(=O)C1 |
| CAS | |
| Splash | |
| Other Names | 1,2,3-Cyclohexanetrione, 2-{2-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)phenyl]hydrazone} |