Systematic / IUPAC Name: N-(5-Fluoro-4-imino-3(4H)-quinazolinyl)isonicotinamide
ID: Reference3852
Other Names: 4-Pyridinecarboxamide, N-(5-fluoro-4-imino-3(4H)-quinazolinyl)-
Formula: C14H10FN5O
N4-(5-Fluoro-4-imino-3,4-dihydroquinazolin-3-yl)isonicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 2:00:03 PM |
| InChI | InChI=1S/C14H10FN5O/c15-10-2-1-3-11-12(10)13(16)20(8-18-11)19-14(21)9-4-6-17-7-5-9/h1-8,16H,(H,19,21) |
| InChI Key | IJOICRJECZOHNZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C(=C1)F)C(=N)N(C=N2)NC(=O)C3=CC=NC=C3 |
| CAS | |
| Splash | |
| Other Names | 4-Pyridinecarboxamide, N-(5-fluoro-4-imino-3(4H)-quinazolinyl)- |