Systematic / IUPAC Name: 6-Amino-4-(methylsulfanyl)-2-thioxo-1,2-dihydro-3,5-pyridinedicarbonitrile
ID: Reference3854
Other Names: 6-Amino-4-(methylsulfanyl)-2-thioxo-1,2-dihydropyridine-3,5-dicarbonitrile
Formula: C8H6N4S2
6-Amino-4-(methylthio)-2-thioxo-1,2-dihydropyridine-3,5-dicarbonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 2:06:59 PM |
| InChI | InChI=1S/C8H6N4S2/c1-14-6-4(2-9)7(11)12-8(13)5(6)3-10/h1H3,(H3,11,12,13) |
| InChI Key | MTXHTSWJCCMDRH-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=C(C(=S)NC(=C1C#N)N)C#N |
| CAS | |
| Splash | |
| Other Names | 6-Amino-4-(methylsulfanyl)-2-thioxo-1,2-dihydropyridine-3,5-dicarbonitrile |