Systematic / IUPAC Name: N-{4-[(4-Bromophenyl)sulfanyl]-3-nitrobenzyl}alanine
ID: Reference3856
Other Names: Alanine, N-({4-[(4-bromophenyl)thio]-3-nitrophenyl}methyl)-
Formula: C16H15BrN2O4S
2-({4-[(4-Bromophenyl)thio]-3-nitrobenzyl}amino)propanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 2:10:29 PM |
| InChI | InChI=1S/C16H15BrN2O4S/c1-10(16(20)21)18-9-11-2-7-15(14(8-11)19(22)23)24-13-5-3-12(17)4-6-13/h2-8,10,18H,9H2,1H3,(H,20,21) |
| InChI Key | LHGLISWQNAPAER-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Alanine, N-({4-[(4-bromophenyl)thio]-3-nitrophenyl}methyl)- |