Systematic / IUPAC Name: 1-(3,4-Dimethylthieno[2,3-b]thiophen-2-yl)-4,4,4-trifluoro-1,3-butanedione
ID: Reference3865
Other Names: 1,3-Butanedione, 1-(3,4-dimethylthieno[2,3-b]thien-2-yl)-4,4,4-trifluoro-
Formula: C12H9F3O2S2
1-(3,4-Dimethylthieno[2,3-b]thiophen-2-yl)-4,4,4-trifluorobutane-1,3-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 2:36:55 PM |
| InChI | InChI=1S/C12H9F3O2S2/c1-5-4-18-11-9(5)6(2)10(19-11)7(16)3-8(17)12(13,14)15/h4H,3H2,1-2H3 |
| InChI Key | PSBOUGLMMMITRO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CSC2=C1C(=C(S2)C(=O)CC(=O)C(F)(F)F)C |
| CAS | |
| Splash | |
| Other Names | 1,3-Butanedione, 1-(3,4-dimethylthieno[2,3-b]thien-2-yl)-4,4,4-trifluoro- |