Systematic / IUPAC Name: (2E)-1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-2-[4-(trifluoromethyl)benzylidene]hydrazine
ID: Reference3867
Other Names: Benzaldehyde, 4-(trifluoromethyl)-, 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazone
Formula: C15H8Cl2F6N2
4-(Trifluoromethyl)benzaldehyde 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 2:43:14 PM |
| InChI | InChI=1S/C15H8Cl2F6N2/c16-11-5-10(15(21,22)23)6-12(17)13(11)25-24-7-8-1-3-9(4-2-8)14(18,19)20/h1-7,25H/b24-7+ |
| InChI Key | BRQJLDBHQBWVPD-HCBMXOAHSA-N |
| Canonical SMILES | C1=CC(=CC=C1C=NNC2=C(C=C(C=C2Cl)C(F)(F)F)Cl)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Benzaldehyde, 4-(trifluoromethyl)-, 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazone |