Systematic / IUPAC Name: 5-Nitro-2-(2-thienylsulfanyl)benzoic acid
ID: Reference3871
Other Names:
Benzoic acid, 5-nitro-2-(2-thienylthio)-;
5-Nitro-2-thiophen-2-ylsulfanylbenzoic acid
Formula: C11H7NO4S2
5-Nitro-2-(2-thienylthio)benzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 149 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/16/2016 9:17:45 AM |
| InChI | InChI=1S/C11H7NO4S2/c13-11(14)8-6-7(12(15)16)3-4-9(8)18-10-2-1-5-17-10/h1-6H,(H,13,14) |
| InChI Key | PBQGICMIRXZYKM-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
Benzoic acid, 5-nitro-2-(2-thienylthio)-; 5-Nitro-2-thiophen-2-ylsulfanylbenzoic acid |