Systematic / IUPAC Name: N-Propyl-2-(2-thienylcarbonyl)hydrazinecarboxamide
ID: Reference3875
Other Names: 2-Thiophenecarboxylic acid, 2-[(propylamino)carbonyl]hydrazide
Formula: C9H13N3O2S
N1-Propyl-2-(2-thienylcarbonyl)hydrazine-1-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/16/2016 9:05:27 AM |
| InChI | InChI=1S/C9H13N3O2S/c1-2-5-10-9(14)12-11-8(13)7-4-3-6-15-7/h3-4,6H,2,5H2,1H3,(H,11,13)(H2,10,12,14) |
| InChI Key | NXKLNOGCVXHADG-UHFFFAOYSA-N |
| Canonical SMILES | CCCNC(=O)NNC(=O)C1=CC=CS1 |
| CAS | |
| Splash | |
| Other Names | 2-Thiophenecarboxylic acid, 2-[(propylamino)carbonyl]hydrazide |