Systematic / IUPAC Name: N,5-Diphenyl-1,3-oxazole-4-carboxamide
ID: Reference3876
Other Names: 4-Oxazolecarboxamide, N,5-diphenyl-
Formula: C16H12N2O2
N4,5-Diphenyl-1,3-oxazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 200 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/16/2016 10:00:36 AM |
| InChI | InChI=1S/C16H12N2O2/c19-16(18-13-9-5-2-6-10-13)14-15(20-11-17-14)12-7-3-1-4-8-12/h1-11H,(H,18,19) |
| InChI Key | QZHYXBRLJHISAC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=C(N=CO2)C(=O)NC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 4-Oxazolecarboxamide, N,5-diphenyl- |