Systematic / IUPAC Name: (3E)-4-(Dimethylamino)-3-{[4-methyl-5-(trifluoromethyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-3-buten-2-one
ID: Reference3878
Other Names: 3-Buten-2-one, 4-(dimethylamino)-3-{[4-methyl-5-(trifluoromethyl)-4H-1,2,4-triazol-3-yl]thio}-, (3E)-
Formula: C10H13F3N4OS
4-(Dimethylamino)-3-{[4-methyl-5-(trifluoromethyl)-4H-1,2,4-triazol-3-yl]thio}but-3-en-2-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/16/2016 10:07:53 AM |
| InChI | InChI=1S/C10H13F3N4OS/c1-6(18)7(5-16(2)3)19-9-15-14-8(17(9)4)10(11,12)13/h5H,1-4H3/b7-5+ |
| InChI Key | DAADIOHTLFZICI-FNORWQNLSA-N |
| Canonical SMILES | CC(=O)C(=CN(C)C)SC1=NN=C(N1C)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 3-Buten-2-one, 4-(dimethylamino)-3-{[4-methyl-5-(trifluoromethyl)-4H-1,2,4-triazol-3-yl]thio}-, (3E)- |