Systematic / IUPAC Name: 2-Butyl-N'1,N'3-bis[(E)-2-thienylmethylene]malonohydrazide
ID: Reference3888
Other Names:
2-Butyl-N'1,N'3-bis[(E)-2-thienylmethylene]malonohydrazide ;
Propanedioic acid, 2-butyl, bis{2-[(1E)-2-thienylmethylene]hydrazide}
Formula: C17H20N4O2S2
N'1,N'3-bis(2-Thienylmethylidene)-2-butylpropanediohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/16/2016 2:21:28 PM |
| InChI | InChI=1S/C17H20N4O2S2/c1-2-3-8-15(16(22)20-18-11-13-6-4-9-24-13)17(23)21-19-12-14-7-5-10-25-14/h4-7,9-12,15H,2-3,8H2,1H3,(H,20,22)(H,21,23)/b18-11+,19-12+ |
| InChI Key | FYZCVRRUFXGICA-GDAWTGGTSA-N |
| Canonical SMILES | CCCCC(C(=O)NN=CC1=CC=CS1)C(=O)NN=CC2=CC=CS2 |
| CAS | |
| Splash | |
| Other Names |
2-Butyl-N'1,N'3-bis[(E)-2-thienylmethylene]malonohydrazide ; Propanedioic acid, 2-butyl, bis{2-[(1E)-2-thienylmethylene]hydrazide} |