Systematic / IUPAC Name: N-Ethyl-2-phenylhydrazinecarbothioamide
ID: Reference3892
Other Names: Hydrazinecarbothioamide,N-ethyl-2-phenyl-
Formula: C9H13N3S
N1-Ethyl-2-phenylhydrazine-1-carbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/16/2016 3:50:36 PM |
| InChI | InChI=1S/C9H13N3S/c1-2-10-9(13)12-11-8-6-4-3-5-7-8/h3-7,11H,2H2,1H3,(H2,10,12,13) |
| InChI Key | DPELBGAJWVGUJS-UHFFFAOYSA-N |
| Canonical SMILES | CCNC(=S)NNC1=CC=CC=C1 |
| CAS | |
| Splash | |
| Other Names | Hydrazinecarbothioamide,N-ethyl-2-phenyl- |
| ChEMBL | CHEMBL1374246 |
| ChemSpider | 2012976 |
| PubChem | 2731067 |