Systematic / IUPAC Name: 1-Benzyl-3-(3,4-dichlorophenyl)-1-[1-(2-hydroxyphenyl)ethyl]thiourea
ID: Reference3894
Other Names:
N-Benzyl-N'-(3,4-dichlorophenyl)-N-[1-(2-hydroxyphenyl)ethyl]thiourea ;
Thiourea, N'-(3,4-dichlorophenyl)-N-[1-(2-hydroxyphenyl)ethyl]-N-(phenylmethyl)-
Formula: C22H20Cl2N2OS
N-Benzyl-N'-(3,4-dichlorophenyl)-N-[1-(2-hydroxyphenyl)ethyl]thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 209 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/17/2016 6:54:40 AM |
| InChI | InChI=1S/C22H20Cl2N2OS/c1-15(18-9-5-6-10-21(18)27)26(14-16-7-3-2-4-8-16)22(28)25-17-11-12-19(23)20(24)13-17/h2-13,15,27H,14H2,1H3,(H,25,28) |
| InChI Key | ZIRBHMQTTIDBKF-UHFFFAOYSA-N |
| Canonical SMILES | CC(C1=CC=CC=C1O)N(CC2=CC=CC=C2)C(=S)NC3=CC(=C(C=C3)Cl)Cl |
| CAS | |
| Splash | |
| Other Names |
N-Benzyl-N'-(3,4-dichlorophenyl)-N-[1-(2-hydroxyphenyl)ethyl]thiourea ; Thiourea, N'-(3,4-dichlorophenyl)-N-[1-(2-hydroxyphenyl)ethyl]-N-(phenylmethyl)- |