Systematic / IUPAC Name: 5-(2-Chloro-6-fluorobenzyl)-6-methyl-2-(methylsulfanyl)-4(1H)-pyrimidinone
ID: Reference3897
Other Names: 4(1H)-Pyrimidinone, 5-[(2-chloro-6-fluorophenyl)methyl]-6-methyl-2-(methylthio)-
Formula: C13H12ClFN2OS
5-(2-Chloro-6-fluorobenzyl)-6-methyl-2-(methylthio)pyrimidin-4-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 210 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/17/2016 8:25:48 AM |
| InChI | InChI=1S/C13H12ClFN2OS/c1-7-8(12(18)17-13(16-7)19-2)6-9-10(14)4-3-5-11(9)15/h3-5H,6H2,1-2H3,(H,16,17,18) |
| InChI Key | XXNZPOVZCFTKBV-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=O)N=C(N1)SC)CC2=C(C=CC=C2Cl)F |
| CAS | |
| Splash | |
| Other Names | 4(1H)-Pyrimidinone, 5-[(2-chloro-6-fluorophenyl)methyl]-6-methyl-2-(methylthio)- |
| ChemSpider | 2011920 |
| PubChem | 2729983 |
| ChEMBL | CHEMBL1478191 |