Systematic / IUPAC Name: 2,6-Dimethoxy-N-[(2,4,6-trifluorophenyl)carbamoyl]benzamide
ID: Reference3907
Other Names: Benzamide, 2,6-dimethoxy-N-{[(2,4,6-trifluorophenyl)amino]carbonyl}-
Formula: C16H13F3N2O4
N-(2,6-Dimethoxybenzoyl)-N'-(2,4,6-trifluorophenyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/17/2016 1:30:48 PM |
| InChI | InChI=1S/C16H13F3N2O4/c1-24-11-4-3-5-12(25-2)13(11)15(22)21-16(23)20-14-9(18)6-8(17)7-10(14)19/h3-7H,1-2H3,(H2,20,21,22,23) |
| InChI Key | OLKWLLXSRAKETP-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C(=CC=C1)OC)C(=O)NC(=O)NC2=C(C=C(C=C2F)F)F |
| CAS | |
| Splash | |
| Other Names | Benzamide, 2,6-dimethoxy-N-{[(2,4,6-trifluorophenyl)amino]carbonyl}- |
| PubChem | 2800190 |
| ChEMBL | CHEMBL1904767 |
| ChemSpider | 2078922 |