Systematic / IUPAC Name: S-(4-Acetyl-3-hydroxy-2-propylphenyl) dimethylcarbamothioate
ID: Reference3916
Other Names: Carbamothioic acid, N,N-dimethyl, S-(4-acetyl-3-hydroxy-2-propylphenyl) ester
Formula: C14H19NO3S
4-Acetyl-3-hydroxy-2-propylphenyl (dimethylamino)methanethioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/18/2016 7:58:26 AM |
| InChI | InChI=1S/C14H19NO3S/c1-5-6-11-12(19-14(18)15(3)4)8-7-10(9(2)16)13(11)17/h7-8,17H,5-6H2,1-4H3 |
| InChI Key | TWNCYHSLYIINQX-UHFFFAOYSA-N |
| Canonical SMILES | CCCC1=C(C=CC(=C1O)C(=O)C)SC(=O)N(C)C |
| CAS | |
| Splash | |
| Other Names | Carbamothioic acid, N,N-dimethyl, S-(4-acetyl-3-hydroxy-2-propylphenyl) ester |