Systematic / IUPAC Name: 3-Nitro-2,6-bis(3-pyridinyloxy)benzonitrile
ID: Reference3917
Other Names: Benzonitrile, 3-nitro-2,6-bis(3-pyridinyloxy)-
Formula: C17H10N4O4
3-Nitro-2,6-bis(3-pyridyloxy)benzonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/18/2016 7:17:35 AM |
| InChI | InChI=1S/C17H10N4O4/c18-9-14-16(24-12-3-1-7-19-10-12)6-5-15(21(22)23)17(14)25-13-4-2-8-20-11-13/h1-8,10-11H |
| InChI Key | WZQVWLXSZYRTAM-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Benzonitrile, 3-nitro-2,6-bis(3-pyridinyloxy)- |