Systematic / IUPAC Name: N-(2-Chloro-6-phenoxybenzyl)-4-fluorobenzenesulfonamide
ID: Reference3918
Other Names: Benzenesulfonamide, N-[(2-chloro-6-phenoxyphenyl)methyl]-4-fluoro-
Formula: C19H15ClFNO3S
N1-(2-Chloro-6-phenoxybenzyl)-4-fluorobenzene-1-sulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 116 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/18/2016 7:52:08 AM |
| InChI | InChI=1S/C19H15ClFNO3S/c20-18-7-4-8-19(25-15-5-2-1-3-6-15)17(18)13-22-26(23,24)16-11-9-14(21)10-12-16/h1-12,22H,13H2 |
| InChI Key | FFCDCTDPRLINOW-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)OC2=C(C(=CC=C2)Cl)CNS(=O)(=O)C3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names | Benzenesulfonamide, N-[(2-chloro-6-phenoxyphenyl)methyl]-4-fluoro- |
| ChemSpider | 2084619 |
| ChEMBL | CHEMBL1382468 |
| PubChem | 2806097 |