Systematic / IUPAC Name: 2,3,4,6-Tetra-O-acetyl-N-(2-nitrophenyl)hexopyranosylamine
ID: Reference3932
Other Names: Hexopyranosylamine, N-(2-nitrophenyl)-, 2,3,4,6-tetraacetate
Formula: C20H24N2O11
3,5-bis(acetyloxy)-2-[(acetyloxy)methyl]-6-(2-nitroanilino)tetrahydro-2H-pyran-4-yl acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 209 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/22/2016 7:49:11 AM |
| InChI | InChI=1S/C20H24N2O11/c1-10(23)29-9-16-17(30-11(2)24)18(31-12(3)25)19(32-13(4)26)20(33-16)21-14-7-5-6-8-15(14)22(27)28/h5-8,16-21H,9H2,1-4H3 |
| InChI Key | VEUZOPHINRTGCP-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Hexopyranosylamine, N-(2-nitrophenyl)-, 2,3,4,6-tetraacetate |