Systematic / IUPAC Name: 5-(Dimethylamino)-1-naphthalenesulfonohydrazide
ID: Reference3934
Other Names:
Dansylhydrazine;
[5-(Dimethylamino)naphthyl]hydrazinosulfone;
1-Dimethylaminophthalene-5-sulphonyl hydrazine;
1-Naphthalenesulfonic acid, 5-(dimethylamino)-hydrazide;
5-(Dimethylamino)-1-naphthalenesulfonic hydrazide
Formula: C12H15N3O2S
5-(Dimethylamino)naphthalene-1-sulfonohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/22/2016 7:55:24 AM |
| InChI | InChI=1S/C12H15N3O2S/c1-15(2)11-7-3-6-10-9(11)5-4-8-12(10)18(16,17)14-13/h3-8,14H,13H2,1-2H3 |
| InChI Key | KPQYDVAFRDWIBW-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)NN |
| CAS | |
| Splash | |
| Other Names |
Dansylhydrazine; [5-(Dimethylamino)naphthyl]hydrazinosulfone; 1-Dimethylaminophthalene-5-sulphonyl hydrazine; 1-Naphthalenesulfonic acid, 5-(dimethylamino)-hydrazide; 5-(Dimethylamino)-1-naphthalenesulfonic hydrazide; 5-Dimethylaminonaphthalene-1-sulphonohydrazide |