Systematic / IUPAC Name: 4-{2-[(4-Chlorophenyl)sulfonyl]ethyl}morpholine
ID: Reference3937
Other Names: Morpholine, 4-{2-[(4-chlorophenyl)sulfonyl]ethyl}-
Formula: C12H16ClNO3S
4-{2-[(4-Chlorophenyl)sulfonyl]ethyl}morpholine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/24/2016 7:54:57 AM |
| InChI | InChI=1S/C12H16ClNO3S/c13-11-1-3-12(4-2-11)18(15,16)10-7-14-5-8-17-9-6-14/h1-4H,5-10H2 |
| InChI Key | OASLHYGUAWCWEL-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCN1CCS(=O)(=O)C2=CC=C(C=C2)Cl |
| CAS | |
| Splash | |
| Other Names | Morpholine, 4-{2-[(4-chlorophenyl)sulfonyl]ethyl}- |
| ChEMBL | CHEMBL3187507 |
| ChemSpider | 2097041 |
| PubChem | 2818796 |