Systematic / IUPAC Name: 4-(Methylsulfanyl)-2-(4-morpholinyl)-6-phenyl-5-pyrimidinecarbonitrile
ID: Reference3940
Other Names: 5-Pyrimidinecarbonitrile, 4-(methylthio)-2-(4-morpholinyl)-6-phenyl-
Formula: C16H16N4OS
4-(Methylthio)-2-morpholino-6-phenylpyrimidine-5-carbonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/24/2016 8:03:20 AM |
| InChI | InChI=1S/C16H16N4OS/c1-22-15-13(11-17)14(12-5-3-2-4-6-12)18-16(19-15)20-7-9-21-10-8-20/h2-6H,7-10H2,1H3 |
| InChI Key | PQARGBXKWSCLOH-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=NC(=NC(=C1C#N)C2=CC=CC=C2)N3CCOCC3 |
| CAS | |
| Splash | |
| Other Names | 5-Pyrimidinecarbonitrile, 4-(methylthio)-2-(4-morpholinyl)-6-phenyl- |