Systematic / IUPAC Name: N-[Methyl(oxido)phenyl-λ6-sulfanylidene]-4-(trifluoromethoxy)benzenesulfonamide
ID: Reference3944
Other Names: Benzenesulfonamide, N-(methyloxidophenylsulfanylidene)-4-(trifluoromethoxy)-
Formula: C14H12F3NO4S2
N1-(1-Methyl-1-oxo-1-phenyl-λ6-sulfanylidene)-4-(trifluoromethoxy)benzene-1-sulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/24/2016 1:38:21 PM |
| InChI | InChI=1S/C14H12F3NO4S2/c1-23(19,12-5-3-2-4-6-12)18-24(20,21)13-9-7-11(8-10-13)22-14(15,16)17/h2-10H,1H3 |
| InChI Key | ZLSARVOYUMTUHB-UHFFFAOYSA-N |
| Canonical SMILES | CS(=NS(=O)(=O)C1=CC=C(C=C1)OC(F)(F)F)(=O)C2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | Benzenesulfonamide, N-(methyloxidophenylsulfanylidene)-4-(trifluoromethoxy)- |