Systematic / IUPAC Name: [5-(2-Amino-6-oxo-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl phosphate
ID: Reference395
Other Names:
6H-Purin-6-one, 2-amino-9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-3,9-dihydro-;
Deoxyguanosine monophosphate;
Deoxyguanylate;
Deoxyguanylic acid;
dGMP
; more
Formula: C10H14N5O7P
Class: Endogenous Metabolites
2'-Deoxyguanosine 5'-monophosphate (dGMP) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 671 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/26/2025 9:11:58 PM |
| InChI | InChI=1S/C10H14N5O7P/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(22-6)2-21-23(18,19)20/h3-6,16H,1-2H2,(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1 |
| InChI Key | LTFMZDNNPPEQNG-KVQBGUIXSA-N |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C2N=C(N=C3O)N)COP(=O)(O)O)O |
| CAS | 25656922 |
| Splash | |
| Other Names |
6H-Purin-6-one, 2-amino-9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-3,9-dihydro-; Deoxyguanosine monophosphate; Deoxyguanylate; Deoxyguanylic acid; dGMP; dCG; Deoxy GMP |
| ChEBI | CHEBI:16192 |
| PubChem | 65059 |
| Wikipedia | Deoxyguanosine monophosphate |
| ChEMBL | CHEMBL477487 |
| HMDb | HMDB01044 |
| ChemSpider | 58570 |
| KEGG | C00362 |
| ChemIDPlus | 000902045; 025656922 |
| DrugBank | 65059 |