Systematic / IUPAC Name: 2-{[2-(1-Piperidinyl)phenyl]carbamoyl}-2-cyclohexene-1-carboxylic acid
ID: Reference3963
Other Names: 2-Cyclohexene-1-carboxylic acid, 2-({[2-(1-piperidinyl)phenyl]amino}carbonyl)-
Formula: C19H24N2O3
2-[(2-Piperidinoanilino)carbonyl]-2-cyclohexene-1-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 189 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/25/2016 3:33:06 PM |
| InChI | InChI=1S/C19H24N2O3/c22-18(14-8-2-3-9-15(14)19(23)24)20-16-10-4-5-11-17(16)21-12-6-1-7-13-21/h4-5,8,10-11,15H,1-3,6-7,9,12-13H2,(H,20,22)(H,23,24) |
| InChI Key | TXFIHWNQICKWKX-UHFFFAOYSA-N |
| Canonical SMILES | C1CCN(CC1)C2=CC=CC=C2NC(=O)C3=CCCCC3C(=O)O |
| CAS | |
| Splash | |
| Other Names | 2-Cyclohexene-1-carboxylic acid, 2-({[2-(1-piperidinyl)phenyl]amino}carbonyl)- |