Systematic / IUPAC Name: 2-(4-Methyl-1-piperazinyl)-N-(2-phenoxyphenyl)acetamide
ID: Reference3967
Other Names: 2-(4-Methylpiperazin-1-yl)-N-(2-phenoxyphenyl)acetamide
Formula: C19H23N3O2
2-(4-Methylpiperazino)-N-(2-phenoxyphenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/26/2016 7:03:17 AM |
| InChI | InChI=1S/C19H23N3O2/c1-21-11-13-22(14-12-21)15-19(23)20-17-9-5-6-10-18(17)24-16-7-3-2-4-8-16/h2-10H,11-15H2,1H3,(H,20,23) |
| InChI Key | GKRKJKAVJFQUNM-UHFFFAOYSA-N |
| Canonical SMILES | CN1CCN(CC1)CC(=O)NC2=CC=CC=C2OC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 2-(4-Methylpiperazin-1-yl)-N-(2-phenoxyphenyl)acetamide |
| PubChem | 2813152 |
| ChEMBL | CHEMBL1446510 |
| ChemSpider | 2091555 |