Systematic / IUPAC Name: 2-(2-Pyridinylsulfanyl)-N-(2-{[4-(trifluoromethyl)-2-pyrimidinyl]sulfanyl}phenyl)acetamide
ID: Reference3986
Other Names: Acetamide, 2-(2-pyridinylthio)-N-(2-{[4-(trifluoromethyl)-2-pyrimidinyl]thio}phenyl)-
Formula: C18H13F3N4OS2
2-(Pyridin-2-ylthio)-N-(2-{[4-(trifluoromethyl)pyrimidin-2-yl]thio}phenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2016 10:15:31 AM |
| InChI | InChI=1S/C18H13F3N4OS2/c19-18(20,21)14-8-10-23-17(25-14)28-13-6-2-1-5-12(13)24-15(26)11-27-16-7-3-4-9-22-16/h1-10H,11H2,(H,24,26) |
| InChI Key | WMCPWBQVCRPMJJ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)NC(=O)CSC2=CC=CC=N2)SC3=NC=CC(=N3)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Acetamide, 2-(2-pyridinylthio)-N-(2-{[4-(trifluoromethyl)-2-pyrimidinyl]thio}phenyl)- |