Systematic / IUPAC Name: 3-{[(2-Chloro-6-fluorophenyl)amino]methylene}-2,4-pentanedione
ID: Reference3991
Other Names: 2,4-Pentanedione, 3-{[(2-chloro-6-fluorophenyl)amino]methylene}-
Formula: C12H11ClFNO2
3-[(2-Chloro-6-fluoroanilino)methylidene]pentane-2,4-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 97 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2016 11:33:17 AM |
| InChI | InChI=1S/C12H11ClFNO2/c1-7(16)9(8(2)17)6-15-12-10(13)4-3-5-11(12)14/h3-6,15H,1-2H3 |
| InChI Key | ORAOZKBUXJNRMF-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)C(=CNC1=C(C=CC=C1Cl)F)C(=O)C |
| CAS | |
| Splash | |
| Other Names | 2,4-Pentanedione, 3-{[(2-chloro-6-fluorophenyl)amino]methylene}- |