Systematic / IUPAC Name: 4-Fluoro-2-[(1E)-N-(2,4,6-trichlorophenyl)ethanehydrazonoyl]phenyl 2-fluorobenzoate
ID: Reference3998
Other Names: Benzoic acid, 2-fluoro-, 4-fluoro-2-[(1E)-1-[2-(2,4,6-trichlorophenyl)hydrazinylidene]ethyl]phenyl ester
Formula: C21H13Cl3F2N2O2
4-fluoro-2-[2-(2,4,6-trichlorophenyl)ethanhydrazonoyl]phenyl 2-fluorobenzoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2016 1:59:01 PM |
| InChI | InChI=1S/C21H13Cl3F2N2O2/c1-11(27-28-20-16(23)8-12(22)9-17(20)24)15-10-13(25)6-7-19(15)30-21(29)14-4-2-3-5-18(14)26/h2-10,28H,1H3/b27-11+ |
| InChI Key | RHXJEIZBXVKKAW-LUOAPIJWSA-N |
| Canonical SMILES | CC(=NNC1=C(C=C(C=C1Cl)Cl)Cl)C2=C(C=CC(=C2)F)OC(=O)C3=CC=CC=C3F |
| CAS | |
| Splash | |
| Other Names | Benzoic acid, 2-fluoro-, 4-fluoro-2-[(1E)-1-[2-(2,4,6-trichlorophenyl)hydrazinylidene]ethyl]phenyl ester |