Systematic / IUPAC Name: Methyl N-(4-aminophenyl)sulfonylcarbamate
ID: Reference40
Other Names:
Methyl sulphanilylcarbamate;
Methyl N-(4-aminobenzenesulfonyl)carbamate;
Methyl 4-aminobenzenesulphonyl carbamate;
Carbamic acid, sulfanilyl, methyl ester;
Methyl ((4-aminophenyl)sulfonyl)carbamate
; more
Formula: C8H10N2O4S
Class: Pesticides/Herbicides
Asulam mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 2125 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 1/15/2015 11:05:42 AM |
| InChI | InChI=1S/C8H10N2O4S/c1-14-8(11)10-15(12,13)7-4-2-6(9)3-5-7/h2-5H,9H2,1H3,(H,10,11) |
| InChI Key | VGPYEHKOIGNJKV-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)NS(=O)(=O)C1=CC=C(C=C1)N |
| CAS | 3337711 |
| Splash | |
| Other Names |
Methyl sulphanilylcarbamate; Methyl N-(4-aminobenzenesulfonyl)carbamate; Methyl 4-aminobenzenesulphonyl carbamate; Carbamic acid, sulfanilyl, methyl ester; Methyl ((4-aminophenyl)sulfonyl)carbamate; Methyl N-(4-aminophenylsulfonyl)carbamate; Methyl 4-aminophenylsulphonyl carbamate; N-1-Methoxycarbonylsulfanilamide; Sulfanilylcarbamic acid methyl ester; Methyl p-aminobenzenesulfonylcarbamate; Methyl (4-aminophenylsulfonyl)carbamate; N-[(4-Aminophenyl)sulfonyl]carbamic acid methyl ester; Asilan; Plakin; Asulox F; Asulox; Jonnix; Asulox 40 |
| ChemSpider | 17707 |
| ChEMBL | CHEMBL2137678 |
| ChemIDPlus | 003337711; 014089431; 002302172 |
| PubChem | 18752 |
| Wikipedia | Asulam |
| WebBook | 3177509551 |