Systematic / IUPAC Name: 1,3-Bis[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea
ID: Reference4002
Other Names: Urea, N,N'-bis[3-(2-chlorophenyl)-5-methyl-4-isoxazolyl]-
Formula: C21H16Cl2N4O3
N,N'-Bis[3-(2-chlorophenyl)-5-methylisoxazol-4-yl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 216 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/29/2016 8:45:57 AM |
| InChI | InChI=1S/C21H16Cl2N4O3/c1-11-17(19(26-29-11)13-7-3-5-9-15(13)22)24-21(28)25-18-12(2)30-27-20(18)14-8-4-6-10-16(14)23/h3-10H,1-2H3,(H2,24,25,28) |
| InChI Key | CPFRTFMHIZRUCH-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)NC(=O)NC3=C(ON=C3C4=CC=CC=C4Cl)C |
| CAS | |
| Splash | |
| Other Names | Urea, N,N'-bis[3-(2-chlorophenyl)-5-methyl-4-isoxazolyl]- |