Systematic / IUPAC Name: [(4-Chlorophenyl)amino]{[(E)-{1-[1-(5-methyl-1,2-oxazol-3-yl)-1H-1,2,4-triazol-3-yl]-2-propanylidene}amino]oxy}methanone
ID: Reference4008
Other Names: 2-Propanone, 1-[1-(5-methyl-3-isoxazolyl)-1H-1,2,4-triazol-3-yl], O-{[(4-chlorophenyl)amino]carbonyl}oxime, (2E)-
Formula: C16H15ClN6O3
3-[2-({[(4-chloroanilino)carbonyl]oxy}imino)propyl]-1-(5-methylisoxazol-3-yl)-1H-1,2,4-triazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 216 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/29/2016 12:26:44 PM |
| InChI | InChI=1S/C16H15ClN6O3/c1-10(21-26-16(24)19-13-5-3-12(17)4-6-13)7-14-18-9-23(20-14)15-8-11(2)25-22-15/h3-6,8-9H,7H2,1-2H3,(H,19,24)/b21-10+ |
| InChI Key | PMESTAPKHLWNIX-UFFVCSGVSA-N |
| Canonical SMILES | CC1=CC(=NO1)N2C=NC(=N2)CC(=NOC(=O)NC3=CC=C(C=C3)Cl)C |
| CAS | |
| Splash | |
| Other Names | 2-Propanone, 1-[1-(5-methyl-3-isoxazolyl)-1H-1,2,4-triazol-3-yl], O-{[(4-chlorophenyl)amino]carbonyl}oxime, (2E)- |