Systematic / IUPAC Name: 1,3-Dibenzylhexahydro-5-pyrimidinecarbonitrile
ID: Reference4016
Other Names: 1,3-Dibenzyl-5-cyanohexahydropyrimidine
Formula: C19H21N3
1,3-Dibenzylhexahydropyrimidine-5-carbonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/1/2016 7:55:14 AM |
| InChI | InChI=1S/C19H21N3/c20-11-19-14-21(12-17-7-3-1-4-8-17)16-22(15-19)13-18-9-5-2-6-10-18/h1-10,19H,12-16H2 |
| InChI Key | PSDQOOQJPHTEIA-UHFFFAOYSA-N |
| Canonical SMILES | C1C(CN(CN1CC2=CC=CC=C2)CC3=CC=CC=C3)C#N |
| CAS | |
| Splash | |
| Other Names | 1,3-Dibenzyl-5-cyanohexahydropyrimidine |
| ChemSpider | 2084548 |
| ChEMBL | CHEMBL1566693 |
| PubChem | 2806026 |