Systematic / IUPAC Name: 1-(2,4-Difluorophenyl)-3-(4-methoxy-2-nitrophenyl)thiourea
ID: Reference4018
Other Names:
N-(2,4-Difluorophenyl)-N'-(4-methoxy-2-nitrophenyl)thiourea ;
Thiourea, N-(2,4-difluorophenyl)-N'-(4-methoxy-2-nitrophenyl)-
Formula: C14H11F2N3O3S
N-(2,4-Difluorophenyl)-N'-(4-methoxy-2-nitrophenyl)thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 107 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/1/2016 8:22:52 AM |
| InChI | InChI=1S/C14H11F2N3O3S/c1-22-9-3-5-12(13(7-9)19(20)21)18-14(23)17-11-4-2-8(15)6-10(11)16/h2-7H,1H3,(H2,17,18,23) |
| InChI Key | PSUFPCPTTRXCER-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
N-(2,4-Difluorophenyl)-N'-(4-methoxy-2-nitrophenyl)thiourea ; Thiourea, N-(2,4-difluorophenyl)-N'-(4-methoxy-2-nitrophenyl)- |