Systematic / IUPAC Name: 2-({[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]carbonyl}amino)-4,5-dimethoxybenzoic acid
ID: Reference4019
Other Names: Benzoic acid, 2-({[3-chloro-5-(trifluoromethyl)-2-pyridinyl]carbonyl}amino)-4,5-dimethoxy-
Formula: C16H12ClF3N2O5
2-({[3-Chloro-5-(trifluoromethyl)-2-pyridyl]carbonyl}amino)-4,5-dimethoxybenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/1/2016 9:38:30 AM |
| InChI | InChI=1S/C16H12ClF3N2O5/c1-26-11-4-8(15(24)25)10(5-12(11)27-2)22-14(23)13-9(17)3-7(6-21-13)16(18,19)20/h3-6H,1-2H3,(H,22,23)(H,24,25) |
| InChI Key | LORFFZAQIFUMLR-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=C(C(=C1)C(=O)O)NC(=O)C2=C(C=C(C=N2)C(F)(F)F)Cl)OC |
| CAS | |
| Splash | |
| Other Names | Benzoic acid, 2-({[3-chloro-5-(trifluoromethyl)-2-pyridinyl]carbonyl}amino)-4,5-dimethoxy- |