Systematic / IUPAC Name: 1-[3,5-Bis(trifluoromethyl)phenyl]-3-[2-(2-oxo-1-imidazolidinyl)ethyl]thiourea
ID: Reference4031
Other Names: Thiourea, N-[3,5-bis(trifluoromethyl)phenyl]-N'-[2-(2-oxo-1-imidazolidinyl)ethyl]-
Formula: C14H14F6N4OS
N-[3,5-bis(trifluoromethyl)phenyl]-N'-[2-(2-oxo-1-imidazolidinyl)ethyl]thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/2/2016 7:45:53 AM |
| InChI | InChI=1S/C14H14F6N4OS/c15-13(16,17)8-5-9(14(18,19)20)7-10(6-8)23-11(26)21-1-3-24-4-2-22-12(24)25/h5-7H,1-4H2,(H,22,25)(H2,21,23,26) |
| InChI Key | ZPMMPPMTBUMGBH-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(C(=O)N1)CCNC(=S)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Thiourea, N-[3,5-bis(trifluoromethyl)phenyl]-N'-[2-(2-oxo-1-imidazolidinyl)ethyl]- |