Systematic / IUPAC Name: 9H-Fluoren-4-yl(1-piperidinyl)methanone
ID: Reference4033
Other Names: Methanone, 9H-fluoren-4-yl-1-piperidinyl-
Formula: C19H19NO
9H-Fluoren-4-yl(piperidino)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/2/2016 8:39:29 AM |
| InChI | InChI=1S/C19H19NO/c21-19(20-11-4-1-5-12-20)17-10-6-8-15-13-14-7-2-3-9-16(14)18(15)17/h2-3,6-10H,1,4-5,11-13H2 |
| InChI Key | AJGMCYGFFBIENV-UHFFFAOYSA-N |
| Canonical SMILES | C1CCN(CC1)C(=O)C2=C3C(=CC=C2)CC4=CC=CC=C43 |
| CAS | |
| Splash | |
| Other Names | Methanone, 9H-fluoren-4-yl-1-piperidinyl- |
| ChemSpider | 2080974 |
| PubChem | 2802294 |
| ChEMBL | CHEMBL1390910 |